C11H11NO5 — CID 171870839
3-(3-formyl-4-hydroxy-5-methoxyphenyl)-2,3-dihydroxypropanenitrile (PubChem CID 171870839) has the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. Its IUPAC name is 3-(3-formyl-4-hydroxy-5-methoxyphenyl)-2,3-dihydroxypropanenitrile.
| Compound Name | 3-(3-formyl-4-hydroxy-5-methoxyphenyl)-2,3-dihydroxypropanenitrile |
|---|---|
| PubChem CID | 171870839 |
| Molecular Formula | C11H11NO5 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 3-(3-formyl-4-hydroxy-5-methoxyphenyl)-2,3-dihydroxypropanenitrile |
| SMILES | COc1cc(C(O)C(O)C#N)cc(C=O)c1O |
| InChI | InChI=1S/C11H11NO5/c1-17-9-3-6(10(15)8(14)4-12)2-7(5-13)11(9)16/h2-3,5,8,10,14-16H,1H3 |
| InChIKey | IOQYFBMRFZSNOH-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|