C8H6F2N2O2 — CID 171869978
3-(5,6-difluoro-3-pyridinyl)-2,3-dihydroxypropanenitrile (PubChem CID 171869978) has the molecular formula C8H6F2N2O2 and a molecular weight of 200.14 g/mol. Its IUPAC name is 3-(5,6-difluoro-3-pyridinyl)-2,3-dihydroxypropanenitrile.
| Compound Name | 3-(5,6-difluoro-3-pyridinyl)-2,3-dihydroxypropanenitrile |
|---|---|
| PubChem CID | 171869978 |
| Molecular Formula | C8H6F2N2O2 |
| Molecular Weight | 200.14 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 3-(5,6-difluoro-3-pyridinyl)-2,3-dihydroxypropanenitrile |
| SMILES | N#CC(O)C(O)c1cnc(F)c(F)c1 |
| InChI | InChI=1S/C8H6F2N2O2/c9-5-1-4(3-12-8(5)10)7(14)6(13)2-11/h1,3,6-7,13-14H |
| InChIKey | DDRGIMSGTBJEQZ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 77.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.14 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|