C10H10N2O4 — CID 171870683
methyl 5-(2-cyano-1,2-dihydroxyethyl)pyridine-2-carboxylate (PubChem CID 171870683) has the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. Its IUPAC name is methyl 5-(2-cyano-1,2-dihydroxyethyl)pyridine-2-carboxylate.
| Compound Name | methyl 5-(2-cyano-1,2-dihydroxyethyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 171870683 |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | methyl 5-(2-cyano-1,2-dihydroxyethyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(O)C(O)C#N)cn1 |
| InChI | InChI=1S/C10H10N2O4/c1-16-10(15)7-3-2-6(5-12-7)9(14)8(13)4-11/h2-3,5,8-9,13-14H,1H3 |
| InChIKey | JMCDUBIOIZCIJV-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 103.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|