C9H9FN2O2 — CID 171869933
3-(6-fluoro-5-methyl-3-pyridinyl)-2,3-dihydroxypropanenitrile (PubChem CID 171869933) has the molecular formula C9H9FN2O2 and a molecular weight of 196.18 g/mol. Its IUPAC name is 3-(6-fluoro-5-methyl-3-pyridinyl)-2,3-dihydroxypropanenitrile.
| Compound Name | 3-(6-fluoro-5-methyl-3-pyridinyl)-2,3-dihydroxypropanenitrile |
|---|---|
| PubChem CID | 171869933 |
| Molecular Formula | C9H9FN2O2 |
| Molecular Weight | 196.18 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 3-(6-fluoro-5-methyl-3-pyridinyl)-2,3-dihydroxypropanenitrile |
| SMILES | Cc1cc(C(O)C(O)C#N)cnc1F |
| InChI | InChI=1S/C9H9FN2O2/c1-5-2-6(4-12-9(5)10)8(14)7(13)3-11/h2,4,7-8,13-14H,1H3 |
| InChIKey | KQHPXHVSPOUAOE-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 77.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.18 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|