C21H21N3O7 — CID 171889442
benzyl N-[3,4-dihydroxy-4-(3-nitro-4-oxo-1H-quinolin-6-yl)butyl]carbamate (PubChem CID 171889442) has the molecular formula C21H21N3O7 and a molecular weight of 427.41 g/mol. Its IUPAC name is benzyl N-[3,4-dihydroxy-4-(3-nitro-4-oxo-1H-quinolin-6-yl)butyl]carbamate.
| Compound Name | benzyl N-[3,4-dihydroxy-4-(3-nitro-4-oxo-1H-quinolin-6-yl)butyl]carbamate |
|---|---|
| PubChem CID | 171889442 |
| Molecular Formula | C21H21N3O7 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | benzyl N-[3,4-dihydroxy-4-(3-nitro-4-oxo-1H-quinolin-6-yl)butyl]carbamate |
| SMILES | O=C(NCCC(O)C(O)c1ccc2[nH]cc([N+](=O)[O-])c(=O)c2c1)OCc1ccccc1 |
| InChI | InChI=1S/C21H21N3O7/c25-18(8-9-22-21(28)31-12-13-4-2-1-3-5-13)19(26)14-6-7-16-15(10-14)20(27)17(11-23-16)24(29)30/h1-7,10-11,18-19,25-26H,8-9,12H2,(H,22,28)(H,23,27) |
| InChIKey | BDEIJQPQUYJUFU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 154.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|