C12H14F2N2O5 — CID 171883741
N-[4-(2,5-difluoro-4-nitrophenyl)-3,4-dihydroxybutyl]acetamide (PubChem CID 171883741) has the molecular formula C12H14F2N2O5 and a molecular weight of 304.25 g/mol. Its IUPAC name is N-[4-(2,5-difluoro-4-nitrophenyl)-3,4-dihydroxybutyl]acetamide.
| Compound Name | N-[4-(2,5-difluoro-4-nitrophenyl)-3,4-dihydroxybutyl]acetamide |
|---|---|
| PubChem CID | 171883741 |
| Molecular Formula | C12H14F2N2O5 |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | N-[4-(2,5-difluoro-4-nitrophenyl)-3,4-dihydroxybutyl]acetamide |
| SMILES | CC(=O)NCCC(O)C(O)c1cc(F)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C12H14F2N2O5/c1-6(17)15-3-2-11(18)12(19)7-4-9(14)10(16(20)21)5-8(7)13/h4-5,11-12,18-19H,2-3H2,1H3,(H,15,17) |
| InChIKey | VHMZQALDAYBJGV-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|