C12H15FN2O5 — CID 170830726
N-[3-(2-fluoro-4-methyl-5-nitrophenyl)-2,3-dihydroxypropyl]acetamide (PubChem CID 170830726) has the molecular formula C12H15FN2O5 and a molecular weight of 286.26 g/mol. Its IUPAC name is N-[3-(2-fluoro-4-methyl-5-nitrophenyl)-2,3-dihydroxypropyl]acetamide.
| Compound Name | N-[3-(2-fluoro-4-methyl-5-nitrophenyl)-2,3-dihydroxypropyl]acetamide |
|---|---|
| PubChem CID | 170830726 |
| Molecular Formula | C12H15FN2O5 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | N-[3-(2-fluoro-4-methyl-5-nitrophenyl)-2,3-dihydroxypropyl]acetamide |
| SMILES | CC(=O)NCC(O)C(O)c1cc([N+](=O)[O-])c(C)cc1F |
| InChI | InChI=1S/C12H15FN2O5/c1-6-3-9(13)8(4-10(6)15(19)20)12(18)11(17)5-14-7(2)16/h3-4,11-12,17-18H,5H2,1-2H3,(H,14,16) |
| InChIKey | CAKURZFCFIZJPQ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|