C11H16N4O5 — CID 170830782
N-[3-(6-amino-4-methyl-5-nitro-3-pyridinyl)-2,3-dihydroxypropyl]acetamide (PubChem CID 170830782) has the molecular formula C11H16N4O5 and a molecular weight of 284.27 g/mol. Its IUPAC name is N-[3-(6-amino-4-methyl-5-nitro-3-pyridinyl)-2,3-dihydroxypropyl]acetamide.
| Compound Name | N-[3-(6-amino-4-methyl-5-nitro-3-pyridinyl)-2,3-dihydroxypropyl]acetamide |
|---|---|
| PubChem CID | 170830782 |
| Molecular Formula | C11H16N4O5 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | N-[3-(6-amino-4-methyl-5-nitro-3-pyridinyl)-2,3-dihydroxypropyl]acetamide |
| SMILES | CC(=O)NCC(O)C(O)c1cnc(N)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C11H16N4O5/c1-5-7(3-14-11(12)9(5)15(19)20)10(18)8(17)4-13-6(2)16/h3,8,10,17-18H,4H2,1-2H3,(H2,12,14)(H,13,16) |
| InChIKey | BCAGUYZQXWQYFA-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 151.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|