C9H12ClN3O4 — CID 170828651
3-amino-1-(6-chloro-4-methyl-5-nitro-3-pyridinyl)propane-1,2-diol (PubChem CID 170828651) has the molecular formula C9H12ClN3O4 and a molecular weight of 261.67 g/mol. Its IUPAC name is 3-amino-1-(6-chloro-4-methyl-5-nitro-3-pyridinyl)propane-1,2-diol.
| Compound Name | 3-amino-1-(6-chloro-4-methyl-5-nitro-3-pyridinyl)propane-1,2-diol |
|---|---|
| PubChem CID | 170828651 |
| Molecular Formula | C9H12ClN3O4 |
| Molecular Weight | 261.67 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 3-amino-1-(6-chloro-4-methyl-5-nitro-3-pyridinyl)propane-1,2-diol |
| SMILES | Cc1c(C(O)C(O)CN)cnc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12ClN3O4/c1-4-5(8(15)6(14)2-11)3-12-9(10)7(4)13(16)17/h3,6,8,14-15H,2,11H2,1H3 |
| InChIKey | NAEIHDQJQYZXOC-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.67 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|