C11H14ClN3O5 — CID 170830684
N-[3-(6-chloro-2-methyl-5-nitro-3-pyridinyl)-2,3-dihydroxypropyl]acetamide (PubChem CID 170830684) has the molecular formula C11H14ClN3O5 and a molecular weight of 303.70 g/mol. Its IUPAC name is N-[3-(6-chloro-2-methyl-5-nitro-3-pyridinyl)-2,3-dihydroxypropyl]acetamide.
| Compound Name | N-[3-(6-chloro-2-methyl-5-nitro-3-pyridinyl)-2,3-dihydroxypropyl]acetamide |
|---|---|
| PubChem CID | 170830684 |
| Molecular Formula | C11H14ClN3O5 |
| Molecular Weight | 303.70 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | N-[3-(6-chloro-2-methyl-5-nitro-3-pyridinyl)-2,3-dihydroxypropyl]acetamide |
| SMILES | CC(=O)NCC(O)C(O)c1cc([N+](=O)[O-])c(Cl)nc1C |
| InChI | InChI=1S/C11H14ClN3O5/c1-5-7(3-8(15(19)20)11(12)14-5)10(18)9(17)4-13-6(2)16/h3,9-10,17-18H,4H2,1-2H3,(H,13,16) |
| InChIKey | CUVTZELDMSKOTG-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.70 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|