C11H12Cl3NO3 — CID 170829873
N-[2,3-dihydroxy-3-(2,3,5-trichlorophenyl)propyl]acetamide (PubChem CID 170829873) has the molecular formula C11H12Cl3NO3 and a molecular weight of 312.58 g/mol. Its IUPAC name is N-[2,3-dihydroxy-3-(2,3,5-trichlorophenyl)propyl]acetamide.
| Compound Name | N-[2,3-dihydroxy-3-(2,3,5-trichlorophenyl)propyl]acetamide |
|---|---|
| PubChem CID | 170829873 |
| Molecular Formula | C11H12Cl3NO3 |
| Molecular Weight | 312.58 g/mol |
| Exact Mass | 310.99 |
| IUPAC Name | N-[2,3-dihydroxy-3-(2,3,5-trichlorophenyl)propyl]acetamide |
| SMILES | CC(=O)NCC(O)C(O)c1cc(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C11H12Cl3NO3/c1-5(16)15-4-9(17)11(18)7-2-6(12)3-8(13)10(7)14/h2-3,9,11,17-18H,4H2,1H3,(H,15,16) |
| InChIKey | KQCCIHYHLNUJMT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.58 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|