C8H9N5O5 — CID 170826420
5-(3-azido-1,2-dihydroxypropyl)-3-nitro-1H-pyridin-2-one (PubChem CID 170826420) has the molecular formula C8H9N5O5 and a molecular weight of 255.19 g/mol. Its IUPAC name is 5-(3-azido-1,2-dihydroxypropyl)-3-nitro-1H-pyridin-2-one.
| Compound Name | 5-(3-azido-1,2-dihydroxypropyl)-3-nitro-1H-pyridin-2-one |
|---|---|
| PubChem CID | 170826420 |
| Molecular Formula | C8H9N5O5 |
| Molecular Weight | 255.19 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 5-(3-azido-1,2-dihydroxypropyl)-3-nitro-1H-pyridin-2-one |
| SMILES | [N-]=[N+]=NCC(O)C(O)c1c[nH]c(=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H9N5O5/c9-12-11-3-6(14)7(15)4-1-5(13(17)18)8(16)10-2-4/h1-2,6-7,14-15H,3H2,(H,10,16) |
| InChIKey | ZKAKNLYEKVVBQY-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 165.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.19 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|