C11H13N5O5 — CID 170826976
N-[4-(3-azido-1,2-dihydroxypropyl)-2-nitrophenyl]acetamide (PubChem CID 170826976) has the molecular formula C11H13N5O5 and a molecular weight of 295.26 g/mol. Its IUPAC name is N-[4-(3-azido-1,2-dihydroxypropyl)-2-nitrophenyl]acetamide.
| Compound Name | N-[4-(3-azido-1,2-dihydroxypropyl)-2-nitrophenyl]acetamide |
|---|---|
| PubChem CID | 170826976 |
| Molecular Formula | C11H13N5O5 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | N-[4-(3-azido-1,2-dihydroxypropyl)-2-nitrophenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(O)C(O)CN=[N+]=[N-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13N5O5/c1-6(17)14-8-3-2-7(4-9(8)16(20)21)11(19)10(18)5-13-15-12/h2-4,10-11,18-19H,5H2,1H3,(H,14,17) |
| InChIKey | MFPQOEXXSCQTNS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 161.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|