C11H12N2O7 — CID 170824911
3-(4-acetamido-3-nitrophenyl)-2,3-dihydroxypropanoic acid (PubChem CID 170824911) has the molecular formula C11H12N2O7 and a molecular weight of 284.22 g/mol. Its IUPAC name is 3-(4-acetamido-3-nitrophenyl)-2,3-dihydroxypropanoic acid.
| Compound Name | 3-(4-acetamido-3-nitrophenyl)-2,3-dihydroxypropanoic acid |
|---|---|
| PubChem CID | 170824911 |
| Molecular Formula | C11H12N2O7 |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 3-(4-acetamido-3-nitrophenyl)-2,3-dihydroxypropanoic acid |
| SMILES | CC(=O)Nc1ccc(C(O)C(O)C(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12N2O7/c1-5(14)12-7-3-2-6(4-8(7)13(19)20)9(15)10(16)11(17)18/h2-4,9-10,15-16H,1H3,(H,12,14)(H,17,18) |
| InChIKey | HYFQCNALLCNCTG-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 150.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|