C9H8N6O4 — CID 170826744
5-(3-azido-1,2-dihydroxypropyl)-3-nitropyridine-2-carbonitrile (PubChem CID 170826744) has the molecular formula C9H8N6O4 and a molecular weight of 264.20 g/mol. Its IUPAC name is 5-(3-azido-1,2-dihydroxypropyl)-3-nitropyridine-2-carbonitrile.
| Compound Name | 5-(3-azido-1,2-dihydroxypropyl)-3-nitropyridine-2-carbonitrile |
|---|---|
| PubChem CID | 170826744 |
| Molecular Formula | C9H8N6O4 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 5-(3-azido-1,2-dihydroxypropyl)-3-nitropyridine-2-carbonitrile |
| SMILES | N#Cc1ncc(C(O)C(O)CN=[N+]=[N-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H8N6O4/c10-2-6-7(15(18)19)1-5(3-12-6)9(17)8(16)4-13-14-11/h1,3,8-9,16-17H,4H2 |
| InChIKey | RSHLIDLEHYQXKF-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 169.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|