C6H7N5O4S — CID 170825704
3-azido-1-(5-nitro-1,3-thiazol-2-yl)propane-1,2-diol (PubChem CID 170825704) has the molecular formula C6H7N5O4S and a molecular weight of 245.22 g/mol. Its IUPAC name is 3-azido-1-(5-nitro-1,3-thiazol-2-yl)propane-1,2-diol.
| Compound Name | 3-azido-1-(5-nitro-1,3-thiazol-2-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 170825704 |
| Molecular Formula | C6H7N5O4S |
| Molecular Weight | 245.22 g/mol |
| Exact Mass | 245.02 |
| IUPAC Name | 3-azido-1-(5-nitro-1,3-thiazol-2-yl)propane-1,2-diol |
| SMILES | [N-]=[N+]=NCC(O)C(O)c1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C6H7N5O4S/c7-10-9-1-3(12)5(13)6-8-2-4(16-6)11(14)15/h2-3,5,12-13H,1H2 |
| InChIKey | PHEADXWKVXPCTG-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 145.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.22 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|