C7H10N6O4 — CID 171879277
4-azido-1-(5-nitro-1H-imidazol-2-yl)butane-1,2-diol (PubChem CID 171879277) has the molecular formula C7H10N6O4 and a molecular weight of 242.19 g/mol. Its IUPAC name is 4-azido-1-(5-nitro-1H-imidazol-2-yl)butane-1,2-diol.
| Compound Name | 4-azido-1-(5-nitro-1H-imidazol-2-yl)butane-1,2-diol |
|---|---|
| PubChem CID | 171879277 |
| Molecular Formula | C7H10N6O4 |
| Molecular Weight | 242.19 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 4-azido-1-(5-nitro-1H-imidazol-2-yl)butane-1,2-diol |
| SMILES | [N-]=[N+]=NCCC(O)C(O)c1ncc([N+](=O)[O-])[nH]1 |
| InChI | InChI=1S/C7H10N6O4/c8-12-10-2-1-4(14)6(15)7-9-3-5(11-7)13(16)17/h3-4,6,14-15H,1-2H2,(H,9,11) |
| InChIKey | ZEGQVCULJVMVQX-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 161.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.19 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|