C12H20N4O6 — CID 171884653
tert-butyl N-[3,4-dihydroxy-4-(5-nitro-1H-imidazol-2-yl)butyl]carbamate (PubChem CID 171884653) has the molecular formula C12H20N4O6 and a molecular weight of 316.31 g/mol. Its IUPAC name is tert-butyl N-[3,4-dihydroxy-4-(5-nitro-1H-imidazol-2-yl)butyl]carbamate.
| Compound Name | tert-butyl N-[3,4-dihydroxy-4-(5-nitro-1H-imidazol-2-yl)butyl]carbamate |
|---|---|
| PubChem CID | 171884653 |
| Molecular Formula | C12H20N4O6 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | tert-butyl N-[3,4-dihydroxy-4-(5-nitro-1H-imidazol-2-yl)butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(O)C(O)c1ncc([N+](=O)[O-])[nH]1 |
| InChI | InChI=1S/C12H20N4O6/c1-12(2,3)22-11(19)13-5-4-7(17)9(18)10-14-6-8(15-10)16(20)21/h6-7,9,17-18H,4-5H2,1-3H3,(H,13,19)(H,14,15) |
| InChIKey | LUSAWTRRYQNBSJ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 150.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|