C11H14O4S — CID 171865532
ethyl 2,3-dihydroxy-3-(2-sulfanylphenyl)propanoate (PubChem CID 171865532) has the molecular formula C11H14O4S and a molecular weight of 242.30 g/mol. Its IUPAC name is ethyl 2,3-dihydroxy-3-(2-sulfanylphenyl)propanoate.
| Compound Name | ethyl 2,3-dihydroxy-3-(2-sulfanylphenyl)propanoate |
|---|---|
| PubChem CID | 171865532 |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | ethyl 2,3-dihydroxy-3-(2-sulfanylphenyl)propanoate |
| SMILES | CCOC(=O)C(O)C(O)c1ccccc1S |
| InChI | InChI=1S/C11H14O4S/c1-2-15-11(14)10(13)9(12)7-5-3-4-6-8(7)16/h3-6,9-10,12-13,16H,2H2,1H3 |
| InChIKey | IGGKMEMNTHSYPE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|