C8H9ClN2OS — CID 169477304
5-(3-chloroprop-1-enyl)-2-methylsulfanyl-1H-pyrimidin-6-one (PubChem CID 169477304) has the molecular formula C8H9ClN2OS and a molecular weight of 216.69 g/mol. Its IUPAC name is 5-(3-chloroprop-1-enyl)-2-methylsulfanyl-1H-pyrimidin-6-one.
| Compound Name | 5-(3-chloroprop-1-enyl)-2-methylsulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 169477304 |
| Molecular Formula | C8H9ClN2OS |
| Molecular Weight | 216.69 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | 5-(3-chloroprop-1-enyl)-2-methylsulfanyl-1H-pyrimidin-6-one |
| SMILES | CSc1ncc(C=CCCl)c(=O)[nH]1 |
| InChI | InChI=1S/C8H9ClN2OS/c1-13-8-10-5-6(3-2-4-9)7(12)11-8/h2-3,5H,4H2,1H3,(H,10,11,12) |
| InChIKey | DGRGGACXGZTQDV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.69 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|