C8H8N2O3 — CID 170483047
4-(6-oxo-1H-pyrimidin-5-yl)but-3-enoic acid (PubChem CID 170483047) has the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. Its IUPAC name is 4-(6-oxo-1H-pyrimidin-5-yl)but-3-enoic acid.
| Compound Name | 4-(6-oxo-1H-pyrimidin-5-yl)but-3-enoic acid |
|---|---|
| PubChem CID | 170483047 |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 4-(6-oxo-1H-pyrimidin-5-yl)but-3-enoic acid |
| SMILES | O=C(O)CC=Cc1cnc[nH]c1=O |
| InChI | InChI=1S/C8H8N2O3/c11-7(12)3-1-2-6-4-9-5-10-8(6)13/h1-2,4-5H,3H2,(H,11,12)(H,9,10,13) |
| InChIKey | MDIGWIUQAKZYKK-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |