C13H5Cl2F9N4 — CID 141239612
1-[2,6-bis(trifluoromethyl)pyrimidin-4-yl]-2-[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazine (PubChem CID 141239612) has the molecular formula C13H5Cl2F9N4 and a molecular weight of 459.10 g/mol. Its IUPAC name is 1-[2,6-bis(trifluoromethyl)pyrimidin-4-yl]-2-[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazine.
| Compound Name | 1-[2,6-bis(trifluoromethyl)pyrimidin-4-yl]-2-[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazine |
|---|---|
| PubChem CID | 141239612 |
| Molecular Formula | C13H5Cl2F9N4 |
| Molecular Weight | 459.10 g/mol |
| Exact Mass | 457.97 |
| IUPAC Name | 1-[2,6-bis(trifluoromethyl)pyrimidin-4-yl]-2-[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazine |
| SMILES | FC(F)(F)c1cc(Cl)c(NNc2cc(C(F)(F)F)nc(C(F)(F)F)n2)c(Cl)c1 |
| InChI | InChI=1S/C13H5Cl2F9N4/c14-5-1-4(11(16,17)18)2-6(15)9(5)28-27-8-3-7(12(19,20)21)25-10(26-8)13(22,23)24/h1-3,28H,(H,25,26,27) |
| InChIKey | JWSFYFSUWMHEHH-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.10 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|