C16H4Cl5F3N2 — CID 157453773
2,3,5-trichloro-6-[[2,6-dichloro-4-(trifluoromethyl)phenyl]methyl]-4-isocyanobenzonitrile (PubChem CID 157453773) has the molecular formula C16H4Cl5F3N2 and a molecular weight of 458.48 g/mol. Its IUPAC name is 2,3,5-trichloro-6-[[2,6-dichloro-4-(trifluoromethyl)phenyl]methyl]-4-isocyanobenzonitrile.
| Compound Name | 2,3,5-trichloro-6-[[2,6-dichloro-4-(trifluoromethyl)phenyl]methyl]-4-isocyanobenzonitrile |
|---|---|
| PubChem CID | 157453773 |
| Molecular Formula | C16H4Cl5F3N2 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 455.88 |
| IUPAC Name | 2,3,5-trichloro-6-[[2,6-dichloro-4-(trifluoromethyl)phenyl]methyl]-4-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1c(Cl)c(Cl)c(C#N)c(Cc2c(Cl)cc(C(F)(F)F)cc2Cl)c1Cl |
| InChI | InChI=1S/C16H4Cl5F3N2/c1-26-15-13(20)7(9(5-25)12(19)14(15)21)4-8-10(17)2-6(3-11(8)18)16(22,23)24/h2-3H,4H2 |
| InChIKey | GMROHBALQMXYEB-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|