C15H5Cl5N2 — CID 159628637
2,4,5-trichloro-6-[(2,6-dichlorophenyl)methyl]-3-isocyanobenzonitrile (PubChem CID 159628637) has the molecular formula C15H5Cl5N2 and a molecular weight of 390.48 g/mol. Its IUPAC name is 2,4,5-trichloro-6-[(2,6-dichlorophenyl)methyl]-3-isocyanobenzonitrile.
| Compound Name | 2,4,5-trichloro-6-[(2,6-dichlorophenyl)methyl]-3-isocyanobenzonitrile |
|---|---|
| PubChem CID | 159628637 |
| Molecular Formula | C15H5Cl5N2 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 387.89 |
| IUPAC Name | 2,4,5-trichloro-6-[(2,6-dichlorophenyl)methyl]-3-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1c(Cl)c(Cl)c(Cc2c(Cl)cccc2Cl)c(C#N)c1Cl |
| InChI | InChI=1S/C15H5Cl5N2/c1-22-15-13(19)9(6-21)7(12(18)14(15)20)5-8-10(16)3-2-4-11(8)17/h2-4H,5H2 |
| InChIKey | KALNXEXHSLSDEN-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|