C15H4Cl4FN3O2 — CID 157453769
2,3,5-trichloro-6-[(2-chloro-6-fluoro-4-nitrophenyl)methyl]-4-isocyanobenzonitrile (PubChem CID 157453769) has the molecular formula C15H4Cl4FN3O2 and a molecular weight of 419.03 g/mol. Its IUPAC name is 2,3,5-trichloro-6-[(2-chloro-6-fluoro-4-nitrophenyl)methyl]-4-isocyanobenzonitrile.
| Compound Name | 2,3,5-trichloro-6-[(2-chloro-6-fluoro-4-nitrophenyl)methyl]-4-isocyanobenzonitrile |
|---|---|
| PubChem CID | 157453769 |
| Molecular Formula | C15H4Cl4FN3O2 |
| Molecular Weight | 419.03 g/mol |
| Exact Mass | 416.90 |
| IUPAC Name | 2,3,5-trichloro-6-[(2-chloro-6-fluoro-4-nitrophenyl)methyl]-4-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1c(Cl)c(Cl)c(C#N)c(Cc2c(F)cc([N+](=O)[O-])cc2Cl)c1Cl |
| InChI | InChI=1S/C15H4Cl4FN3O2/c1-22-15-13(18)7(9(5-21)12(17)14(15)19)4-8-10(16)2-6(23(24)25)3-11(8)20/h2-3H,4H2 |
| InChIKey | UDQGWXZJTPEEIA-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.03 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|