C14H8ClF2N3O6 — CID 161472534
2-chloro-4-[(2,6-difluoro-4-nitrophenyl)methyl]-3-methyl-1,5-dinitrobenzene (PubChem CID 161472534) has the molecular formula C14H8ClF2N3O6 and a molecular weight of 387.68 g/mol. Its IUPAC name is 2-chloro-4-[(2,6-difluoro-4-nitrophenyl)methyl]-3-methyl-1,5-dinitrobenzene.
| Compound Name | 2-chloro-4-[(2,6-difluoro-4-nitrophenyl)methyl]-3-methyl-1,5-dinitrobenzene |
|---|---|
| PubChem CID | 161472534 |
| Molecular Formula | C14H8ClF2N3O6 |
| Molecular Weight | 387.68 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | 2-chloro-4-[(2,6-difluoro-4-nitrophenyl)methyl]-3-methyl-1,5-dinitrobenzene |
| SMILES | Cc1c(Cl)c([N+](=O)[O-])cc([N+](=O)[O-])c1Cc1c(F)cc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C14H8ClF2N3O6/c1-6-8(12(19(23)24)5-13(14(6)15)20(25)26)4-9-10(16)2-7(18(21)22)3-11(9)17/h2-3,5H,4H2,1H3 |
| InChIKey | WWEVFMUJKMLZFQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.68 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|