C12H11ClFNO4 — CID 152935062
1-(2-chloro-3-fluoro-5-nitrophenyl)hexane-1,4-dione (PubChem CID 152935062) has the molecular formula C12H11ClFNO4 and a molecular weight of 287.67 g/mol. Its IUPAC name is 1-(2-chloro-3-fluoro-5-nitrophenyl)hexane-1,4-dione.
| Compound Name | 1-(2-chloro-3-fluoro-5-nitrophenyl)hexane-1,4-dione |
|---|---|
| PubChem CID | 152935062 |
| Molecular Formula | C12H11ClFNO4 |
| Molecular Weight | 287.67 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 1-(2-chloro-3-fluoro-5-nitrophenyl)hexane-1,4-dione |
| SMILES | CCC(=O)CCC(=O)c1cc([N+](=O)[O-])cc(F)c1Cl |
| InChI | InChI=1S/C12H11ClFNO4/c1-2-8(16)3-4-11(17)9-5-7(15(18)19)6-10(14)12(9)13/h5-6H,2-4H2,1H3 |
| InChIKey | ULSAGFKQKQQAFY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.67 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|