C15H10ClF3N2O3 — CID 134418769
2-chloro-N-(2,2-difluoro-2-phenylethyl)-3-fluoro-5-nitrobenzamide (PubChem CID 134418769) has the molecular formula C15H10ClF3N2O3 and a molecular weight of 358.70 g/mol. Its IUPAC name is 2-chloro-N-(2,2-difluoro-2-phenylethyl)-3-fluoro-5-nitrobenzamide.
| Compound Name | 2-chloro-N-(2,2-difluoro-2-phenylethyl)-3-fluoro-5-nitrobenzamide |
|---|---|
| PubChem CID | 134418769 |
| Molecular Formula | C15H10ClF3N2O3 |
| Molecular Weight | 358.70 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 2-chloro-N-(2,2-difluoro-2-phenylethyl)-3-fluoro-5-nitrobenzamide |
| SMILES | O=C(NCC(F)(F)c1ccccc1)c1cc([N+](=O)[O-])cc(F)c1Cl |
| InChI | InChI=1S/C15H10ClF3N2O3/c16-13-11(6-10(21(23)24)7-12(13)17)14(22)20-8-15(18,19)9-4-2-1-3-5-9/h1-7H,8H2,(H,20,22) |
| InChIKey | BHRGOFMPHJVAFA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.70 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|