C16H12ClF3N2O4 — CID 90498003
2-chloro-4-nitro-N-(3,3,3-trifluoro-2-hydroxy-2-phenylpropyl)benzamide (PubChem CID 90498003) has the molecular formula C16H12ClF3N2O4 and a molecular weight of 388.73 g/mol. Its IUPAC name is 2-chloro-4-nitro-N-(3,3,3-trifluoro-2-hydroxy-2-phenylpropyl)benzamide.
| Compound Name | 2-chloro-4-nitro-N-(3,3,3-trifluoro-2-hydroxy-2-phenylpropyl)benzamide |
|---|---|
| PubChem CID | 90498003 |
| Molecular Formula | C16H12ClF3N2O4 |
| Molecular Weight | 388.73 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 2-chloro-4-nitro-N-(3,3,3-trifluoro-2-hydroxy-2-phenylpropyl)benzamide |
| SMILES | O=C(NCC(O)(c1ccccc1)C(F)(F)F)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C16H12ClF3N2O4/c17-13-8-11(22(25)26)6-7-12(13)14(23)21-9-15(24,16(18,19)20)10-4-2-1-3-5-10/h1-8,24H,9H2,(H,21,23) |
| InChIKey | DBKYEZBNXHZCID-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.73 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|