C15H5BrClF3N2 — CID 160839294
2-[(4-bromo-2-chlorophenyl)methyl]-3,5,6-trifluoro-4-isocyanobenzonitrile (PubChem CID 160839294) has the molecular formula C15H5BrClF3N2 and a molecular weight of 385.57 g/mol. Its IUPAC name is 2-[(4-bromo-2-chlorophenyl)methyl]-3,5,6-trifluoro-4-isocyanobenzonitrile.
| Compound Name | 2-[(4-bromo-2-chlorophenyl)methyl]-3,5,6-trifluoro-4-isocyanobenzonitrile |
|---|---|
| PubChem CID | 160839294 |
| Molecular Formula | C15H5BrClF3N2 |
| Molecular Weight | 385.57 g/mol |
| Exact Mass | 383.93 |
| IUPAC Name | 2-[(4-bromo-2-chlorophenyl)methyl]-3,5,6-trifluoro-4-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1c(F)c(F)c(C#N)c(Cc2ccc(Br)cc2Cl)c1F |
| InChI | InChI=1S/C15H5BrClF3N2/c1-22-15-13(19)9(10(6-21)12(18)14(15)20)4-7-2-3-8(16)5-11(7)17/h2-3,5H,4H2 |
| InChIKey | BJQJXYZRBKSVLA-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|