C27H16Cl4N4 — CID 159987004
2,6-dichloro-3-[6-[2-[6-(2,4-dichloro-3-isocyanophenyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]benzonitrile (PubChem CID 159987004) has the molecular formula C27H16Cl4N4 and a molecular weight of 538.27 g/mol. Its IUPAC name is 2,6-dichloro-3-[6-[2-[6-(2,4-dichloro-3-isocyanophenyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]benzonitrile.
| Compound Name | 2,6-dichloro-3-[6-[2-[6-(2,4-dichloro-3-isocyanophenyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]benzonitrile |
|---|---|
| PubChem CID | 159987004 |
| Molecular Formula | C27H16Cl4N4 |
| Molecular Weight | 538.27 g/mol |
| Exact Mass | 536.01 |
| IUPAC Name | 2,6-dichloro-3-[6-[2-[6-(2,4-dichloro-3-isocyanophenyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]benzonitrile |
| SMILES | [C-]#[N+]c1c(Cl)ccc(-c2cccc(C(C)(C)c3cccc(-c4ccc(Cl)c(C#N)c4Cl)n3)n2)c1Cl |
| InChI | InChI=1S/C27H16Cl4N4/c1-27(2,22-8-4-6-20(34-22)15-10-12-18(28)17(14-32)24(15)30)23-9-5-7-21(35-23)16-11-13-19(29)26(33-3)25(16)31/h4-13H,1-2H3 |
| InChIKey | LHLPOSXKWIDAKH-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 53.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.27 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|