C16H4Cl5N3 — CID 161367362
2,4,5-trichloro-6-[(2,6-dichloro-4-cyanophenyl)methyl]-3-isocyanobenzonitrile (PubChem CID 161367362) has the molecular formula C16H4Cl5N3 and a molecular weight of 415.49 g/mol. Its IUPAC name is 2,4,5-trichloro-6-[(2,6-dichloro-4-cyanophenyl)methyl]-3-isocyanobenzonitrile.
| Compound Name | 2,4,5-trichloro-6-[(2,6-dichloro-4-cyanophenyl)methyl]-3-isocyanobenzonitrile |
|---|---|
| PubChem CID | 161367362 |
| Molecular Formula | C16H4Cl5N3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 412.88 |
| IUPAC Name | 2,4,5-trichloro-6-[(2,6-dichloro-4-cyanophenyl)methyl]-3-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1c(Cl)c(Cl)c(Cc2c(Cl)cc(C#N)cc2Cl)c(C#N)c1Cl |
| InChI | InChI=1S/C16H4Cl5N3/c1-24-16-14(20)10(6-23)8(13(19)15(16)21)4-9-11(17)2-7(5-22)3-12(9)18/h2-3H,4H2 |
| InChIKey | WFZQJXBBMQUJKY-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 51.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|