C17H8N4 — CID 58299044
5-[(3-cyano-5-isocyanophenyl)methyl]benzene-1,3-dicarbonitrile (PubChem CID 58299044) has the molecular formula C17H8N4 and a molecular weight of 268.28 g/mol. Its IUPAC name is 5-[(3-cyano-5-isocyanophenyl)methyl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-[(3-cyano-5-isocyanophenyl)methyl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 58299044 |
| Molecular Formula | C17H8N4 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 5-[(3-cyano-5-isocyanophenyl)methyl]benzene-1,3-dicarbonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)cc(Cc2cc(C#N)cc(C#N)c2)c1 |
| InChI | InChI=1S/C17H8N4/c1-21-17-7-13(5-16(8-17)11-20)2-12-3-14(9-18)6-15(4-12)10-19/h3-8H,2H2 |
| InChIKey | MWOILZXFHDXXAA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 75.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|