C34H14N8 — CID 166038644
3-[6-(3-cyano-5-isocyanophenyl)quinoxalino[2,3-a]phenazin-7-yl]-5-isocyanobenzonitrile (PubChem CID 166038644) has the molecular formula C34H14N8 and a molecular weight of 534.54 g/mol. Its IUPAC name is 3-[6-(3-cyano-5-isocyanophenyl)quinoxalino[2,3-a]phenazin-7-yl]-5-isocyanobenzonitrile.
| Compound Name | 3-[6-(3-cyano-5-isocyanophenyl)quinoxalino[2,3-a]phenazin-7-yl]-5-isocyanobenzonitrile |
|---|---|
| PubChem CID | 166038644 |
| Molecular Formula | C34H14N8 |
| Molecular Weight | 534.54 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | 3-[6-(3-cyano-5-isocyanophenyl)quinoxalino[2,3-a]phenazin-7-yl]-5-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)cc(-c2c(-c3cc(C#N)cc([N+]#[C-])c3)c3nc4ccccc4nc3c3nc4ccccc4nc23)c1 |
| InChI | InChI=1S/C34H14N8/c1-37-23-13-19(17-35)11-21(15-23)29-30(22-12-20(18-36)14-24(16-22)38-2)32-34(42-28-10-6-4-8-26(28)40-32)33-31(29)39-25-7-3-5-9-27(25)41-33/h3-16H |
| InChIKey | QODKVEJDSYAQOY-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 107.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.54 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|