C52H30N4 — CID 140768976
5-[4-[10-[10-[4-(5-isocyano-3-pyridinyl)phenyl]anthracen-9-yl]anthracen-9-yl]phenyl]pyridine-3-carbonitrile (PubChem CID 140768976) has the molecular formula C52H30N4 and a molecular weight of 710.84 g/mol. Its IUPAC name is 5-[4-[10-[10-[4-(5-isocyano-3-pyridinyl)phenyl]anthracen-9-yl]anthracen-9-yl]phenyl]pyridine-3-carbonitrile.
| Compound Name | 5-[4-[10-[10-[4-(5-isocyano-3-pyridinyl)phenyl]anthracen-9-yl]anthracen-9-yl]phenyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 140768976 |
| Molecular Formula | C52H30N4 |
| Molecular Weight | 710.84 g/mol |
| Exact Mass | 710.25 |
| IUPAC Name | 5-[4-[10-[10-[4-(5-isocyano-3-pyridinyl)phenyl]anthracen-9-yl]anthracen-9-yl]phenyl]pyridine-3-carbonitrile |
| SMILES | [C-]#[N+]c1cncc(-c2ccc(-c3c4ccccc4c(-c4c5ccccc5c(-c5ccc(-c6cncc(C#N)c6)cc5)c5ccccc45)c4ccccc34)cc2)c1 |
| InChI | InChI=1S/C52H30N4/c1-54-40-27-39(31-56-32-40)35-20-24-37(25-21-35)50-43-12-4-8-16-47(43)52(48-17-9-5-13-44(48)50)51-45-14-6-2-10-41(45)49(42-11-3-7-15-46(42)51)36-22-18-34(19-23-36)38-26-33(28-53)29-55-30-38/h2-27,29-32H |
| InChIKey | XSQUZKMBJQLJMV-UHFFFAOYSA-N |
| XLogP | 13.85 |
| TPSA | 53.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.84 |
| LogP ≤ 5 | 13.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|