C36H20N4S — CID 140769085
5-[3-[8-[3-(5-isocyano-3-pyridinyl)phenyl]dibenzothiophen-2-yl]phenyl]pyridine-3-carbonitrile (PubChem CID 140769085) has the molecular formula C36H20N4S and a molecular weight of 540.65 g/mol. Its IUPAC name is 5-[3-[8-[3-(5-isocyano-3-pyridinyl)phenyl]dibenzothiophen-2-yl]phenyl]pyridine-3-carbonitrile.
| Compound Name | 5-[3-[8-[3-(5-isocyano-3-pyridinyl)phenyl]dibenzothiophen-2-yl]phenyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 140769085 |
| Molecular Formula | C36H20N4S |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | 5-[3-[8-[3-(5-isocyano-3-pyridinyl)phenyl]dibenzothiophen-2-yl]phenyl]pyridine-3-carbonitrile |
| SMILES | [C-]#[N+]c1cncc(-c2cccc(-c3ccc4sc5ccc(-c6cccc(-c7cncc(C#N)c7)c6)cc5c4c3)c2)c1 |
| InChI | InChI=1S/C36H20N4S/c1-38-32-15-31(21-40-22-32)27-7-3-5-25(14-27)29-9-11-36-34(17-29)33-16-28(8-10-35(33)41-36)24-4-2-6-26(13-24)30-12-23(18-37)19-39-20-30/h2-17,19-22H |
| InChIKey | YDYZPMPZUGFZRW-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 53.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|