C34H20N4 — CID 140769516
5-[3-[4-[3-(5-isocyano-3-pyridinyl)phenyl]naphthalen-1-yl]phenyl]pyridine-3-carbonitrile (PubChem CID 140769516) has the molecular formula C34H20N4 and a molecular weight of 484.56 g/mol. Its IUPAC name is 5-[3-[4-[3-(5-isocyano-3-pyridinyl)phenyl]naphthalen-1-yl]phenyl]pyridine-3-carbonitrile.
| Compound Name | 5-[3-[4-[3-(5-isocyano-3-pyridinyl)phenyl]naphthalen-1-yl]phenyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 140769516 |
| Molecular Formula | C34H20N4 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 5-[3-[4-[3-(5-isocyano-3-pyridinyl)phenyl]naphthalen-1-yl]phenyl]pyridine-3-carbonitrile |
| SMILES | [C-]#[N+]c1cncc(-c2cccc(-c3ccc(-c4cccc(-c5cncc(C#N)c5)c4)c4ccccc34)c2)c1 |
| InChI | InChI=1S/C34H20N4/c1-36-30-17-29(21-38-22-30)25-7-5-9-27(16-25)32-13-12-31(33-10-2-3-11-34(32)33)26-8-4-6-24(15-26)28-14-23(18-35)19-37-20-28/h2-17,19-22H |
| InChIKey | USXPKLNSSNKFSR-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 53.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|