C32H16N4O — CID 140769149
5-[21-(5-isocyano-3-pyridinyl)-10-oxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaen-14-yl]pyridine-3-carbonitrile (PubChem CID 140769149) has the molecular formula C32H16N4O and a molecular weight of 472.51 g/mol. Its IUPAC name is 5-[21-(5-isocyano-3-pyridinyl)-10-oxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaen-14-yl]pyridine-3-carbonitrile.
| Compound Name | 5-[21-(5-isocyano-3-pyridinyl)-10-oxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaen-14-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 140769149 |
| Molecular Formula | C32H16N4O |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 5-[21-(5-isocyano-3-pyridinyl)-10-oxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaen-14-yl]pyridine-3-carbonitrile |
| SMILES | [C-]#[N+]c1cncc(-c2c3ccccc3c(-c3cncc(C#N)c3)c3cc4oc5ccccc5c4cc23)c1 |
| InChI | InChI=1S/C32H16N4O/c1-34-22-11-21(17-36-18-22)32-25-8-3-2-7-24(25)31(20-10-19(14-33)15-35-16-20)28-13-30-26(12-27(28)32)23-6-4-5-9-29(23)37-30/h2-13,15-18H |
| InChIKey | GIZAHPACJLOQAU-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 67.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|