C24H12N4O — CID 118397843
5-[7-(5-cyano-3-pyridinyl)dibenzofuran-3-yl]pyridine-3-carbonitrile (PubChem CID 118397843) has the molecular formula C24H12N4O and a molecular weight of 372.39 g/mol. Its IUPAC name is 5-[7-(5-cyano-3-pyridinyl)dibenzofuran-3-yl]pyridine-3-carbonitrile.
| Compound Name | 5-[7-(5-cyano-3-pyridinyl)dibenzofuran-3-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 118397843 |
| Molecular Formula | C24H12N4O |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 5-[7-(5-cyano-3-pyridinyl)dibenzofuran-3-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1cncc(-c2ccc3c(c2)oc2cc(-c4cncc(C#N)c4)ccc23)c1 |
| InChI | InChI=1S/C24H12N4O/c25-9-15-5-19(13-27-11-15)17-1-3-21-22-4-2-18(8-24(22)29-23(21)7-17)20-6-16(10-26)12-28-14-20/h1-8,11-14H |
| InChIKey | CGODIJDXEGNTEW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 86.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |