C60H20N12O — CID 135252734
2-[3-[7-[3,5-bis(2,4,6-tricyanophenyl)phenyl]dibenzofuran-3-yl]-5-(2,4,6-tricyanophenyl)phenyl]benzene-1,3,5-tricarbonitrile (PubChem CID 135252734) has the molecular formula C60H20N12O and a molecular weight of 924.90 g/mol. Its IUPAC name is 2-[3-[7-[3,5-bis(2,4,6-tricyanophenyl)phenyl]dibenzofuran-3-yl]-5-(2,4,6-tricyanophenyl)phenyl]benzene-1,3,5-tricarbonitrile.
| Compound Name | 2-[3-[7-[3,5-bis(2,4,6-tricyanophenyl)phenyl]dibenzofuran-3-yl]-5-(2,4,6-tricyanophenyl)phenyl]benzene-1,3,5-tricarbonitrile |
|---|---|
| PubChem CID | 135252734 |
| Molecular Formula | C60H20N12O |
| Molecular Weight | 924.90 g/mol |
| Exact Mass | 924.19 |
| IUPAC Name | 2-[3-[7-[3,5-bis(2,4,6-tricyanophenyl)phenyl]dibenzofuran-3-yl]-5-(2,4,6-tricyanophenyl)phenyl]benzene-1,3,5-tricarbonitrile |
| SMILES | N#Cc1cc(C#N)c(-c2cc(-c3ccc4c(c3)oc3cc(-c5cc(-c6c(C#N)cc(C#N)cc6C#N)cc(-c6c(C#N)cc(C#N)cc6C#N)c5)ccc34)cc(-c3c(C#N)cc(C#N)cc3C#N)c2)c(C#N)c1 |
| InChI | InChI=1S/C60H20N12O/c61-21-33-5-45(25-65)57(46(6-33)26-66)41-13-39(14-42(17-41)58-47(27-67)7-34(22-62)8-48(58)28-68)37-1-3-53-54-4-2-38(20-56(54)73-55(53)19-37)40-15-43(59-49(29-69)9-35(23-63)10-50(59)30-70)18-44(16-40)60-51(31-71)11-36(24-64)12-52(60)32-72/h1-20H |
| InChIKey | XNPDXMLQECTYDD-UHFFFAOYSA-N |
| XLogP | 12.05 |
| TPSA | 298.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 73 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.90 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |