C21H11N3 — CID 126496826
2-(3-phenylphenyl)benzene-1,3,5-tricarbonitrile (PubChem CID 126496826) has the molecular formula C21H11N3 and a molecular weight of 305.34 g/mol. Its IUPAC name is 2-(3-phenylphenyl)benzene-1,3,5-tricarbonitrile.
| Compound Name | 2-(3-phenylphenyl)benzene-1,3,5-tricarbonitrile |
|---|---|
| PubChem CID | 126496826 |
| Molecular Formula | C21H11N3 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 2-(3-phenylphenyl)benzene-1,3,5-tricarbonitrile |
| SMILES | N#Cc1cc(C#N)c(-c2cccc(-c3ccccc3)c2)c(C#N)c1 |
| InChI | InChI=1S/C21H11N3/c22-12-15-9-19(13-23)21(20(10-15)14-24)18-8-4-7-17(11-18)16-5-2-1-3-6-16/h1-11H |
| InChIKey | CJXNTNGGUCQKAN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |