C54H32N2 — CID 166868365
5-[3-[7,10-bis(3-phenylphenyl)fluoranthen-8-yl]phenyl]benzene-1,3-dicarbonitrile (PubChem CID 166868365) has the molecular formula C54H32N2 and a molecular weight of 708.86 g/mol. Its IUPAC name is 5-[3-[7,10-bis(3-phenylphenyl)fluoranthen-8-yl]phenyl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-[3-[7,10-bis(3-phenylphenyl)fluoranthen-8-yl]phenyl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 166868365 |
| Molecular Formula | C54H32N2 |
| Molecular Weight | 708.86 g/mol |
| Exact Mass | 708.26 |
| IUPAC Name | 5-[3-[7,10-bis(3-phenylphenyl)fluoranthen-8-yl]phenyl]benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)cc(-c2cccc(-c3cc(-c4cccc(-c5ccccc5)c4)c4c(c3-c3cccc(-c5ccccc5)c3)-c3cccc5cccc-4c35)c2)c1 |
| InChI | InChI=1S/C54H32N2/c55-33-35-26-36(34-56)28-46(27-35)42-20-8-21-43(30-42)49-32-50(44-22-7-18-40(29-44)37-12-3-1-4-13-37)53-47-24-10-16-39-17-11-25-48(51(39)47)54(53)52(49)45-23-9-19-41(31-45)38-14-5-2-6-15-38/h1-32H |
| InChIKey | HJNQMUUTTRDJMS-UHFFFAOYSA-N |
| XLogP | 14.23 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.86 |
| LogP ≤ 5 | 14.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |