C33H19N5 — CID 122435734
2-[4-(10-phenylphenazin-5-yl)phenyl]benzene-1,3,5-tricarbonitrile (PubChem CID 122435734) has the molecular formula C33H19N5 and a molecular weight of 485.55 g/mol. Its IUPAC name is 2-[4-(10-phenylphenazin-5-yl)phenyl]benzene-1,3,5-tricarbonitrile.
| Compound Name | 2-[4-(10-phenylphenazin-5-yl)phenyl]benzene-1,3,5-tricarbonitrile |
|---|---|
| PubChem CID | 122435734 |
| Molecular Formula | C33H19N5 |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 2-[4-(10-phenylphenazin-5-yl)phenyl]benzene-1,3,5-tricarbonitrile |
| SMILES | N#Cc1cc(C#N)c(-c2ccc(N3c4ccccc4N(c4ccccc4)c4ccccc43)cc2)c(C#N)c1 |
| InChI | InChI=1S/C33H19N5/c34-20-23-18-25(21-35)33(26(19-23)22-36)24-14-16-28(17-15-24)38-31-12-6-4-10-29(31)37(27-8-2-1-3-9-27)30-11-5-7-13-32(30)38/h1-19H |
| InChIKey | BMCWQRUSZUJDTH-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 77.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |