C32H20N3OP — CID 140898944
5-[4-(10-oxo-10-phenylphenophosphazinin-5-yl)phenyl]benzene-1,3-dicarbonitrile (PubChem CID 140898944) has the molecular formula C32H20N3OP and a molecular weight of 493.51 g/mol. Its IUPAC name is 5-[4-(10-oxo-10-phenylphenophosphazinin-5-yl)phenyl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-[4-(10-oxo-10-phenylphenophosphazinin-5-yl)phenyl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 140898944 |
| Molecular Formula | C32H20N3OP |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 5-[4-(10-oxo-10-phenylphenophosphazinin-5-yl)phenyl]benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)cc(-c2ccc(N3c4ccccc4P(=O)(c4ccccc4)c4ccccc43)cc2)c1 |
| InChI | InChI=1S/C32H20N3OP/c33-21-23-18-24(22-34)20-26(19-23)25-14-16-27(17-15-25)35-29-10-4-6-12-31(29)37(36,28-8-2-1-3-9-28)32-13-7-5-11-30(32)35/h1-20H |
| InChIKey | SXVCVKMCYUCERI-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|