C55H38BrN7 — CID 155673815
2-[2-bromo-4,6-bis[10-(3,5-dimethylphenyl)phenazin-5-yl]phenyl]benzene-1,3,5-tricarbonitrile (PubChem CID 155673815) has the molecular formula C55H38BrN7 and a molecular weight of 876.86 g/mol. Its IUPAC name is 2-[2-bromo-4,6-bis[10-(3,5-dimethylphenyl)phenazin-5-yl]phenyl]benzene-1,3,5-tricarbonitrile.
| Compound Name | 2-[2-bromo-4,6-bis[10-(3,5-dimethylphenyl)phenazin-5-yl]phenyl]benzene-1,3,5-tricarbonitrile |
|---|---|
| PubChem CID | 155673815 |
| Molecular Formula | C55H38BrN7 |
| Molecular Weight | 876.86 g/mol |
| Exact Mass | 875.24 |
| IUPAC Name | 2-[2-bromo-4,6-bis[10-(3,5-dimethylphenyl)phenazin-5-yl]phenyl]benzene-1,3,5-tricarbonitrile |
| SMILES | Cc1cc(C)cc(N2c3ccccc3N(c3cc(Br)c(-c4c(C#N)cc(C#N)cc4C#N)c(N4c5ccccc5N(c5cc(C)cc(C)c5)c5ccccc54)c3)c3ccccc32)c1 |
| InChI | InChI=1S/C55H38BrN7/c1-34-21-35(2)24-41(23-34)60-45-13-5-7-15-47(45)62(48-16-8-6-14-46(48)60)43-29-44(56)55(54-39(32-58)27-38(31-57)28-40(54)33-59)53(30-43)63-51-19-11-9-17-49(51)61(50-18-10-12-20-52(50)63)42-25-36(3)22-37(4)26-42/h5-30H,1-4H3 |
| InChIKey | FQZZRSRQCWXXKL-UHFFFAOYSA-N |
| XLogP | 15.47 |
| TPSA | 84.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.86 |
| LogP ≤ 5 | 15.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |