C39H36BN3 — CID 156690569
11-tert-butyl-8,14-bis(3,5-dimethylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15,17,19-nonaene-4-carbonitrile (PubChem CID 156690569) has the molecular formula C39H36BN3 and a molecular weight of 557.55 g/mol. Its IUPAC name is 11-tert-butyl-8,14-bis(3,5-dimethylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15,17,19-nonaene-4-carbonitrile.
| Compound Name | 11-tert-butyl-8,14-bis(3,5-dimethylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15,17,19-nonaene-4-carbonitrile |
|---|---|
| PubChem CID | 156690569 |
| Molecular Formula | C39H36BN3 |
| Molecular Weight | 557.55 g/mol |
| Exact Mass | 557.30 |
| IUPAC Name | 11-tert-butyl-8,14-bis(3,5-dimethylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15,17,19-nonaene-4-carbonitrile |
| SMILES | Cc1cc(C)cc(N2c3ccccc3B3c4cc(C#N)ccc4N(c4cc(C)cc(C)c4)c4cc(C(C)(C)C)cc2c43)c1 |
| InChI | InChI=1S/C39H36BN3/c1-24-14-25(2)17-30(16-24)42-34-11-9-8-10-32(34)40-33-20-28(23-41)12-13-35(33)43(31-18-26(3)15-27(4)19-31)37-22-29(39(5,6)7)21-36(42)38(37)40/h8-22H,1-7H3 |
| InChIKey | VPOAETXDKGDWDC-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.55 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|