C51H47BN2 — CID 163653205
4-tert-butyl-8-(4-tert-butylphenyl)-14-(3,5-diphenylphenyl)-11-methyl-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15,17,19-nonaene (PubChem CID 163653205) has the molecular formula C51H47BN2 and a molecular weight of 698.76 g/mol. Its IUPAC name is 4-tert-butyl-8-(4-tert-butylphenyl)-14-(3,5-diphenylphenyl)-11-methyl-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15,17,19-nonaene.
| Compound Name | 4-tert-butyl-8-(4-tert-butylphenyl)-14-(3,5-diphenylphenyl)-11-methyl-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15,17,19-nonaene |
|---|---|
| PubChem CID | 163653205 |
| Molecular Formula | C51H47BN2 |
| Molecular Weight | 698.76 g/mol |
| Exact Mass | 698.38 |
| IUPAC Name | 4-tert-butyl-8-(4-tert-butylphenyl)-14-(3,5-diphenylphenyl)-11-methyl-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15,17,19-nonaene |
| SMILES | Cc1cc2c3c(c1)N(c1ccc(C(C)(C)C)cc1)c1ccc(C(C)(C)C)cc1B3c1ccccc1N2c1cc(-c2ccccc2)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C51H47BN2/c1-34-28-47-49-48(29-34)54(42-31-37(35-16-10-8-11-17-35)30-38(32-42)36-18-12-9-13-19-36)45-21-15-14-20-43(45)52(49)44-33-40(51(5,6)7)24-27-46(44)53(47)41-25-22-39(23-26-41)50(2,3)4/h8-33H,1-7H3 |
| InChIKey | INZFKNPIEGHFBX-UHFFFAOYSA-N |
| XLogP | 12.01 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.76 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|