C39H39BN2 — CID 156677108
4-tert-butyl-8-(4-tert-butylphenyl)-14-phenyl-11-(trideuteriomethyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15,17,19-nonaene (PubChem CID 156677108) has the molecular formula C39H39BN2 and a molecular weight of 549.59 g/mol. Its IUPAC name is 4-tert-butyl-8-(4-tert-butylphenyl)-14-phenyl-11-(trideuteriomethyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15,17,19-nonaene.
| Compound Name | 4-tert-butyl-8-(4-tert-butylphenyl)-14-phenyl-11-(trideuteriomethyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15,17,19-nonaene |
|---|---|
| PubChem CID | 156677108 |
| Molecular Formula | C39H39BN2 |
| Molecular Weight | 549.59 g/mol |
| Exact Mass | 549.34 |
| IUPAC Name | 4-tert-butyl-8-(4-tert-butylphenyl)-14-phenyl-11-(trideuteriomethyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15,17,19-nonaene |
| SMILES | [2H]C([2H])([2H])c1cc2c3c(c1)N(c1ccc(C(C)(C)C)cc1)c1ccc(C(C)(C)C)cc1B3c1ccccc1N2c1ccccc1 |
| InChI | InChI=1S/C39H39BN2/c1-26-23-35-37-36(24-26)42(30-20-17-27(18-21-30)38(2,3)4)34-22-19-28(39(5,6)7)25-32(34)40(37)31-15-11-12-16-33(31)41(35)29-13-9-8-10-14-29/h8-25H,1-7H3/i1D3 |
| InChIKey | FRKHPDBXYUYAEL-FIBGUPNXSA-N |
| XLogP | 8.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.59 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|