C60H65BN2 — CID 168845316
4,18-ditert-butyl-8,14-bis(4-tert-butylphenyl)-11-(1,1-diphenylethyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene (PubChem CID 168845316) has the molecular formula C60H65BN2 and a molecular weight of 825.01 g/mol. Its IUPAC name is 4,18-ditert-butyl-8,14-bis(4-tert-butylphenyl)-11-(1,1-diphenylethyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 4,18-ditert-butyl-8,14-bis(4-tert-butylphenyl)-11-(1,1-diphenylethyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 168845316 |
| Molecular Formula | C60H65BN2 |
| Molecular Weight | 825.01 g/mol |
| Exact Mass | 824.52 |
| IUPAC Name | 4,18-ditert-butyl-8,14-bis(4-tert-butylphenyl)-11-(1,1-diphenylethyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
| SMILES | CC(C)(C)c1ccc(N2c3ccc(C(C)(C)C)cc3B3c4cc(C(C)(C)C)ccc4N(c4ccc(C(C)(C)C)cc4)c4cc(C(C)(c5ccccc5)c5ccccc5)cc2c43)cc1 |
| InChI | InChI=1S/C60H65BN2/c1-56(2,3)40-24-30-47(31-25-40)62-51-34-28-44(58(7,8)9)36-49(51)61-50-37-45(59(10,11)12)29-35-52(50)63(48-32-26-41(27-33-48)57(4,5)6)54-39-46(38-53(62)55(54)61)60(13,42-20-16-14-17-21-42)43-22-18-15-19-23-43/h14-39H,1-13H3 |
| InChIKey | HBKYMQVKAVFGJM-UHFFFAOYSA-N |
| XLogP | 14.31 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.01 |
| LogP ≤ 5 | 14.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|