C49H61BN2Si — CID 142467053
[4,18-ditert-butyl-8,14-bis(4-tert-butylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-11-yl]-trimethylsilane (PubChem CID 142467053) has the molecular formula C49H61BN2Si and a molecular weight of 716.94 g/mol. Its IUPAC name is [4,18-ditert-butyl-8,14-bis(4-tert-butylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-11-yl]-trimethylsilane.
| Compound Name | [4,18-ditert-butyl-8,14-bis(4-tert-butylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-11-yl]-trimethylsilane |
|---|---|
| PubChem CID | 142467053 |
| Molecular Formula | C49H61BN2Si |
| Molecular Weight | 716.94 g/mol |
| Exact Mass | 716.47 |
| IUPAC Name | [4,18-ditert-butyl-8,14-bis(4-tert-butylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-11-yl]-trimethylsilane |
| SMILES | CC(C)(C)c1ccc(N2c3ccc(C(C)(C)C)cc3B3c4cc(C(C)(C)C)ccc4N(c4ccc(C(C)(C)C)cc4)c4cc([Si](C)(C)C)cc2c43)cc1 |
| InChI | InChI=1S/C49H61BN2Si/c1-46(2,3)32-16-22-36(23-17-32)51-41-26-20-34(48(7,8)9)28-39(41)50-40-29-35(49(10,11)12)21-27-42(40)52(37-24-18-33(19-25-37)47(4,5)6)44-31-38(53(13,14)15)30-43(51)45(44)50/h16-31H,1-15H3 |
| InChIKey | DLDZYSPBIWSSCH-UHFFFAOYSA-N |
| XLogP | 11.50 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.94 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|